About [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate
[cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate (PubChem CID 118120871) has the molecular formula C19H15Cl2N3O2
and a molecular weight of 388.25 g/mol. Its IUPAC name is [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate.
Molecular Properties
| Compound Name | [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate |
| PubChem CID | 118120871 |
| Molecular Formula | C19H15Cl2N3O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate |
| SMILES | CC(=O)OC(C#N)c1ccc2c(C)nn(Cc3c(Cl)cccc3Cl)c2c1 |
| InChI | InChI=1S/C19H15Cl2N3O2/c1-11-14-7-6-13(19(9-22)26-12(2)25)8-18(14)24(23-11)10-15-16(20)4-3-5-17(15)21/h3-8,19H,10H2,1-2H3 |
| InChIKey | IAVAZIPLTAKGTJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate?
The IUPAC name of [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate (CID 118120871) is [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate.
What is the SMILES notation for [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate?
The canonical SMILES for [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate is CC(=O)OC(C#N)c1ccc2c(C)nn(Cc3c(Cl)cccc3Cl)c2c1.
What is the InChIKey of [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate?
The InChIKey is IAVAZIPLTAKGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15Cl2N3O2/c1-11-14-7-6-13(19(9-22)26-12(2)25)8-18(14)24(23-11)10-15-16(20)4-3-5-17(15)21/h3-8,19H,10H2,1-2H3.
What are the key properties of [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate?
[cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate has a molecular weight of 388.25 g/mol, XLogP of 4.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano-[1-[(2,6-dichlorophenyl)methyl]-3-methylindazol-6-yl]methyl] acetate is sourced from PubChem (CID 118120871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).