C18H15ClF2N2O4S2 — CID 118121088
2-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4,5-difluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 118121088) has the molecular formula C18H15ClF2N2O4S2 and a molecular weight of 460.91 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4,5-difluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4,5-difluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118121088 |
| Molecular Formula | C18H15ClF2N2O4S2 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-chloro-N-[(2,4-dimethoxyphenyl)methyl]-4,5-difluoro-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc(F)c(F)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H15ClF2N2O4S2/c1-26-12-4-3-11(16(7-12)27-2)10-23(18-22-5-6-28-18)29(24,25)17-9-15(21)14(20)8-13(17)19/h3-9H,10H2,1-2H3 |
| InChIKey | BNBDWTWSPHRNKJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|