C8H12N2O — CID 118121095
1-[(1E,3Z)-hexa-1,3,5-trienyl]-1-methylurea (PubChem CID 118121095) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 1-[(1E,3Z)-hexa-1,3,5-trienyl]-1-methylurea.
| Compound Name | 1-[(1E,3Z)-hexa-1,3,5-trienyl]-1-methylurea |
|---|---|
| PubChem CID | 118121095 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-[(1E,3Z)-hexa-1,3,5-trienyl]-1-methylurea |
| SMILES | C=C/C=C\C=C\N(C)C(N)=O |
| InChI | InChI=1S/C8H12N2O/c1-3-4-5-6-7-10(2)8(9)11/h3-7H,1H2,2H3,(H2,9,11)/b5-4-,7-6+ |
| InChIKey | IQYMYACHTCIXKS-SCFJQAPRSA-N |
| XLogP | 1.25 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|