C19H28N6O4S — CID 11812162
(E)-3-[(1R,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]prop-2-enoic acid (PubChem CID 11812162) has the molecular formula C19H28N6O4S and a molecular weight of 436.54 g/mol. Its IUPAC name is (E)-3-[(1R,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]prop-2-enoic acid.
| Compound Name | (E)-3-[(1R,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11812162 |
| Molecular Formula | C19H28N6O4S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (E)-3-[(1R,2R,3S,4R)-4-[7-(butylamino)-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2,3-dihydroxycyclopentyl]prop-2-enoic acid |
| SMILES | CCCCNc1nc(SCCC)nc2c1nnn2[C@@H]1C[C@H](/C=C/C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H28N6O4S/c1-3-5-8-20-17-14-18(22-19(21-17)30-9-4-2)25(24-23-14)12-10-11(6-7-13(26)27)15(28)16(12)29/h6-7,11-12,15-16,28-29H,3-5,8-10H2,1-2H3,(H,26,27)(H,20,21,22)/b7-6+/t11-,12+,15+,16-/m0/s1 |
| InChIKey | OPRXGAAUYAMCGC-HVDVDUFWSA-N |
| XLogP | 1.86 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|