C26H31NO5 — CID 11812187
3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methyl-5-phenyl-3-(phenylmethoxymethyl)-1,2-oxazole (PubChem CID 11812187) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methyl-5-phenyl-3-(phenylmethoxymethyl)-1,2-oxazole.
| Compound Name | 3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methyl-5-phenyl-3-(phenylmethoxymethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 11812187 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 3-[(3aR,5S,6R,6aR)-2,2,6-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-methyl-5-phenyl-3-(phenylmethoxymethyl)-1,2-oxazole |
| SMILES | C[C@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C1(COCc2ccccc2)C=C(c2ccccc2)ON1C |
| InChI | InChI=1S/C26H31NO5/c1-18-22-24(31-25(2,3)30-22)29-23(18)26(17-28-16-19-11-7-5-8-12-19)15-21(32-27(26)4)20-13-9-6-10-14-20/h5-15,18,22-24H,16-17H2,1-4H3/t18-,22+,23-,24+,26?/m0/s1 |
| InChIKey | KLAJICOUGLVKII-WYDRFEHLSA-N |
| XLogP | 4.37 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |