C13H21N7O2 — CID 118122174
[4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide (PubChem CID 118122174) has the molecular formula C13H21N7O2 and a molecular weight of 307.36 g/mol. Its IUPAC name is [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide.
| Compound Name | [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide |
|---|---|
| PubChem CID | 118122174 |
| Molecular Formula | C13H21N7O2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [4,6-bis(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide |
| SMILES | CC(C)Nc1nc(NC(C)C)nc(N(C#N)CC(=O)CO)n1 |
| InChI | InChI=1S/C13H21N7O2/c1-8(2)15-11-17-12(16-9(3)4)19-13(18-11)20(7-14)5-10(22)6-21/h8-9,21H,5-6H2,1-4H3,(H2,15,16,17,18,19) |
| InChIKey | BIVSATKMHFZAOE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|