C14H23N7O2 — CID 118122181
[4-(tert-butylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide (PubChem CID 118122181) has the molecular formula C14H23N7O2 and a molecular weight of 321.39 g/mol. Its IUPAC name is [4-(tert-butylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide.
| Compound Name | [4-(tert-butylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide |
|---|---|
| PubChem CID | 118122181 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [4-(tert-butylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-(3-hydroxy-2-oxopropyl)cyanamide |
| SMILES | CC(C)Nc1nc(NC(C)(C)C)nc(N(C#N)CC(=O)CO)n1 |
| InChI | InChI=1S/C14H23N7O2/c1-9(2)16-11-17-12(20-14(3,4)5)19-13(18-11)21(8-15)6-10(23)7-22/h9,22H,6-7H2,1-5H3,(H2,16,17,18,19,20) |
| InChIKey | USZDPYMVQNPBDL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|