C16H23N3O4S — CID 118122462
(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 118122462) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 118122462 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(pyridin-3-ylmethoxy)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C[C@H](OCc1cccnc1)[C@H]1O[C@@H]2SC(N(C)C)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H23N3O4S/c1-9(22-8-10-5-4-6-17-7-10)14-13(21)12(20)11-15(23-14)24-16(18-11)19(2)3/h4-7,9,11-15,20-21H,8H2,1-3H3/t9-,11+,12+,13-,14+,15+/m0/s1 |
| InChIKey | CSYTWXUWHAFHRZ-MMKLUXSESA-N |
| XLogP | 0.47 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |