C19H25FN2O4S — CID 118122485
(1R,2R,6R,8R,9S)-8-[(1S)-1-[(4-fluorophenyl)methoxy]ethyl]-N,11,11-trimethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine (PubChem CID 118122485) has the molecular formula C19H25FN2O4S and a molecular weight of 396.48 g/mol. Its IUPAC name is (1R,2R,6R,8R,9S)-8-[(1S)-1-[(4-fluorophenyl)methoxy]ethyl]-N,11,11-trimethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine.
| Compound Name | (1R,2R,6R,8R,9S)-8-[(1S)-1-[(4-fluorophenyl)methoxy]ethyl]-N,11,11-trimethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine |
|---|---|
| PubChem CID | 118122485 |
| Molecular Formula | C19H25FN2O4S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1R,2R,6R,8R,9S)-8-[(1S)-1-[(4-fluorophenyl)methoxy]ethyl]-N,11,11-trimethyl-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-amine |
| SMILES | CNC1=N[C@@H]2[C@H]3OC(C)(C)O[C@@H]3[C@@H]([C@H](C)OCc3ccc(F)cc3)O[C@@H]2S1 |
| InChI | InChI=1S/C19H25FN2O4S/c1-10(23-9-11-5-7-12(20)8-6-11)14-16-15(25-19(2,3)26-16)13-17(24-14)27-18(21-4)22-13/h5-8,10,13-17H,9H2,1-4H3,(H,21,22)/t10-,13+,14+,15+,16+,17+/m0/s1 |
| InChIKey | QUGROFBNBDRAOQ-ICSCMOCLSA-N |
| XLogP | 2.67 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |