C11H21N3O3S — CID 118122576
(3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(methylamino)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 118122576) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(methylamino)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(methylamino)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 118122576 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-(dimethylamino)-5-[(1S)-1-(methylamino)ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CN[C@@H](C)[C@H]1O[C@@H]2SC(N(C)C)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H21N3O3S/c1-5(12-2)9-8(16)7(15)6-10(17-9)18-11(13-6)14(3)4/h5-10,12,15-16H,1-4H3/t5-,6+,7+,8-,9+,10+/m0/s1 |
| InChIKey | CPRWCZDIOFGEKJ-LZISRMJESA-N |
| XLogP | -0.93 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |