C26H38N2O4 — CID 11812274
(1S,4R)-2-[(1R,2R)-2-[[(1S,4R)-1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclohexyl]imino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 11812274) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is (1S,4R)-2-[(1R,2R)-2-[[(1S,4R)-1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclohexyl]imino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (1S,4R)-2-[(1R,2R)-2-[[(1S,4R)-1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclohexyl]imino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 11812274 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | (1S,4R)-2-[(1R,2R)-2-[[(1S,4R)-1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene]amino]cyclohexyl]imino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)O)/C(=N/[C@@H]1CCCC[C@H]1/N=C1\C[C@H]3CC[C@]1(C(=O)O)C3(C)C)C2 |
| InChI | InChI=1S/C26H38N2O4/c1-23(2)15-9-11-25(23,21(29)30)19(13-15)27-17-7-5-6-8-18(17)28-20-14-16-10-12-26(20,22(31)32)24(16,3)4/h15-18H,5-14H2,1-4H3,(H,29,30)(H,31,32)/b27-19+,28-20+/t15-,16-,17-,18-,25+,26+/m1/s1 |
| InChIKey | BXIBOFUFFKGZEO-JUXZMBEASA-N |
| XLogP | 5.00 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|