About 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete
2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete (PubChem CID 118123134) has the molecular formula C26H23N3
and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete.
Molecular Properties
| Compound Name | 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete |
| PubChem CID | 118123134 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete |
| SMILES | C1=CCCC(c2cccc(-c3cccc(Cn4nc(-c5ccccc5)[nH]4)c3)c2)=C1 |
| InChI | InChI=1S/C26H23N3/c1-3-10-21(11-4-1)24-15-8-16-25(18-24)23-14-7-9-20(17-23)19-29-27-26(28-29)22-12-5-2-6-13-22/h1-3,5-10,12-18H,4,11,19H2,(H,27,28) |
| InChIKey | ZOXGFHSHMBOZQO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete?
The IUPAC name of 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete (CID 118123134) is 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete.
What is the SMILES notation for 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete?
The canonical SMILES for 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete is C1=CCCC(c2cccc(-c3cccc(Cn4nc(-c5ccccc5)[nH]4)c3)c2)=C1.
What is the InChIKey of 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete?
The InChIKey is ZOXGFHSHMBOZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23N3/c1-3-10-21(11-4-1)24-15-8-16-25(18-24)23-14-7-9-20(17-23)19-29-27-26(28-29)22-12-5-2-6-13-22/h1-3,5-10,12-18H,4,11,19H2,(H,27,28).
What are the key properties of 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete?
2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete has a molecular weight of 377.49 g/mol, XLogP of 6.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(3-cyclohexa-1,3-dien-1-ylphenyl)phenyl]methyl]-4-phenyl-1H-triazete is sourced from PubChem (CID 118123134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).