C52H31F4N3O — CID 118123159
6-[3-(2-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-9-(4-dibenzofuran-4-ylphenyl)-1,2,3,4-tetrafluorocarbazole (PubChem CID 118123159) has the molecular formula C52H31F4N3O and a molecular weight of 789.83 g/mol. Its IUPAC name is 6-[3-(2-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-9-(4-dibenzofuran-4-ylphenyl)-1,2,3,4-tetrafluorocarbazole.
| Compound Name | 6-[3-(2-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-9-(4-dibenzofuran-4-ylphenyl)-1,2,3,4-tetrafluorocarbazole |
|---|---|
| PubChem CID | 118123159 |
| Molecular Formula | C52H31F4N3O |
| Molecular Weight | 789.83 g/mol |
| Exact Mass | 789.24 |
| IUPAC Name | 6-[3-(2-cyclohexa-2,4-dien-1-yl-6-phenylpyrimidin-4-yl)phenyl]-9-(4-dibenzofuran-4-ylphenyl)-1,2,3,4-tetrafluorocarbazole |
| SMILES | Fc1c(F)c(F)c2c(c1F)c1cc(-c3cccc(-c4cc(-c5ccccc5)nc(C5C=CC=CC5)n4)c3)ccc1n2-c1ccc(-c2cccc3c2oc2ccccc23)cc1 |
| InChI | InChI=1S/C52H31F4N3O/c53-46-45-40-28-34(33-15-9-16-35(27-33)42-29-41(31-11-3-1-4-12-31)57-52(58-42)32-13-5-2-6-14-32)23-26-43(40)59(50(45)49(56)48(55)47(46)54)36-24-21-30(22-25-36)37-18-10-19-39-38-17-7-8-20-44(38)60-51(37)39/h1-13,15-29,32H,14H2 |
| InChIKey | KSKFHEKLSSJABK-UHFFFAOYSA-N |
| XLogP | 14.30 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.83 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|