C14H24N2 — CID 118123301
4-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridine (PubChem CID 118123301) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 4-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridine.
| Compound Name | 4-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridine |
|---|---|
| PubChem CID | 118123301 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 4-[3-(1-methylpiperidin-4-yl)propyl]-1,2-dihydropyridine |
| SMILES | CN1CCC(CCCC2=CCNC=C2)CC1 |
| InChI | InChI=1S/C14H24N2/c1-16-11-7-14(8-12-16)4-2-3-13-5-9-15-10-6-13/h5-6,9,14-15H,2-4,7-8,10-12H2,1H3 |
| InChIKey | VWXGJNNQZHCGDR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |