About CID 11812335
CID 11812335 (PubChem CID 11812335) has the molecular formula C30H23NO3
and a molecular weight of 445.52 g/mol.
Molecular Properties
| Compound Name | CID 11812335 |
| PubChem CID | 11812335 |
| Molecular Formula | C30H23NO3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | — |
| SMILES | CN1C[C@@H](c2ccccc2)[C@@]2(COc3ccccc3C2=O)C12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C30H23NO3/c1-31-17-24(19-9-3-2-4-10-19)29(18-34-25-16-6-5-13-21(25)27(29)32)30(31)23-15-8-12-20-11-7-14-22(26(20)23)28(30)33/h2-16,24H,17-18H2,1H3/t24-,29+,30?/m0/s1 |
| InChIKey | XEZVONLSWISHIC-SVLXRIGYSA-N |
| XLogP | 5.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11812335 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11812335?
The IUPAC name of CID 11812335 (CID 11812335) is not available.
What is the SMILES notation for CID 11812335?
The canonical SMILES for CID 11812335 is CN1C[C@@H](c2ccccc2)[C@@]2(COc3ccccc3C2=O)C12C(=O)c1cccc3cccc2c13.
What is the InChIKey of CID 11812335?
The InChIKey is XEZVONLSWISHIC-SVLXRIGYSA-N. The full InChI is InChI=1S/C30H23NO3/c1-31-17-24(19-9-3-2-4-10-19)29(18-34-25-16-6-5-13-21(25)27(29)32)30(31)23-15-8-12-20-11-7-14-22(26(20)23)28(30)33/h2-16,24H,17-18H2,1H3/t24-,29+,30?/m0/s1.
What are the key properties of CID 11812335?
CID 11812335 has a molecular weight of 445.52 g/mol, XLogP of 5.22, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11812335 is sourced from PubChem (CID 11812335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).