C15H28O4 — CID 118123382
(4S,5Z,7R)-7-(2-methoxyethoxymethoxymethyl)-5-methylnona-1,5-dien-4-ol (PubChem CID 118123382) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (4S,5Z,7R)-7-(2-methoxyethoxymethoxymethyl)-5-methylnona-1,5-dien-4-ol.
| Compound Name | (4S,5Z,7R)-7-(2-methoxyethoxymethoxymethyl)-5-methylnona-1,5-dien-4-ol |
|---|---|
| PubChem CID | 118123382 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (4S,5Z,7R)-7-(2-methoxyethoxymethoxymethyl)-5-methylnona-1,5-dien-4-ol |
| SMILES | C=CC[C@H](O)/C(C)=C\[C@@H](CC)COCOCCOC |
| InChI | InChI=1S/C15H28O4/c1-5-7-15(16)13(3)10-14(6-2)11-19-12-18-9-8-17-4/h5,10,14-16H,1,6-9,11-12H2,2-4H3/b13-10-/t14-,15+/m1/s1 |
| InChIKey | QMEBKCHYUNZXNR-GHRAKNKNSA-N |
| XLogP | 2.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|