C22H32N2O2 — CID 118123767
(1R,9S,13R)-10-(cyclopropylmethyl)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one (PubChem CID 118123767) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is (1R,9S,13R)-10-(cyclopropylmethyl)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one.
| Compound Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
|---|---|
| PubChem CID | 118123767 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | (1R,9S,13R)-10-(cyclopropylmethyl)-4-[(1-hydroxy-2-methylpropan-2-yl)amino]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-one |
| SMILES | C[C@H]1[C@H]2C(=O)c3ccc(NC(C)(C)CO)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C22H32N2O2/c1-14-19-20(26)17-8-7-16(23-21(2,3)13-25)11-18(17)22(14,4)9-10-24(19)12-15-5-6-15/h7-8,11,14-15,19,23,25H,5-6,9-10,12-13H2,1-4H3/t14-,19-,22+/m0/s1 |
| InChIKey | QQYFZOOTKZHQPE-OSGPJOMKSA-N |
| XLogP | 3.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |