C26H20F3N5O2S — CID 118124069
2-(5-methylsulfonyl-3-pyridinyl)-5-phenyl-N-(2,2,2-trifluoro-1-phenylethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 118124069) has the molecular formula C26H20F3N5O2S and a molecular weight of 523.54 g/mol. Its IUPAC name is 2-(5-methylsulfonyl-3-pyridinyl)-5-phenyl-N-(2,2,2-trifluoro-1-phenylethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-(5-methylsulfonyl-3-pyridinyl)-5-phenyl-N-(2,2,2-trifluoro-1-phenylethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 118124069 |
| Molecular Formula | C26H20F3N5O2S |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 2-(5-methylsulfonyl-3-pyridinyl)-5-phenyl-N-(2,2,2-trifluoro-1-phenylethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CS(=O)(=O)c1cncc(-c2nc(NC(c3ccccc3)C(F)(F)F)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C26H20F3N5O2S/c1-37(35,36)20-14-19(15-30-16-20)24-32-25(31-23(26(27,28)29)18-10-6-3-7-11-18)22-21(12-13-34(22)33-24)17-8-4-2-5-9-17/h2-16,23H,1H3,(H,31,32,33) |
| InChIKey | LEPAAGGHFRJWKP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |