C25H26F2N4O3 — CID 118124071
4-[(3,5-difluoro-4-pyrazol-1-ylphenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 118124071) has the molecular formula C25H26F2N4O3 and a molecular weight of 468.50 g/mol. Its IUPAC name is 4-[(3,5-difluoro-4-pyrazol-1-ylphenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | 4-[(3,5-difluoro-4-pyrazol-1-ylphenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 118124071 |
| Molecular Formula | C25H26F2N4O3 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-[(3,5-difluoro-4-pyrazol-1-ylphenyl)methyl]-N-[(1S,2S)-2-hydroxycyclohexyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)C1CN(Cc2cc(F)c(-n3cccn3)c(F)c2)c2ccccc2O1 |
| InChI | InChI=1S/C25H26F2N4O3/c26-17-12-16(13-18(27)24(17)31-11-5-10-28-31)14-30-15-23(34-22-9-4-2-7-20(22)30)25(33)29-19-6-1-3-8-21(19)32/h2,4-5,7,9-13,19,21,23,32H,1,3,6,8,14-15H2,(H,29,33)/t19-,21-,23?/m0/s1 |
| InChIKey | ZRLRWLXOTRBYLE-XTIMDYPVSA-N |
| XLogP | 3.34 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |