C24H21N7O — CID 118124145
2-(5-methyl-3-pyridinyl)-5-phenyl-N-(2-pyrazin-2-yloxyethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 118124145) has the molecular formula C24H21N7O and a molecular weight of 423.48 g/mol. Its IUPAC name is 2-(5-methyl-3-pyridinyl)-5-phenyl-N-(2-pyrazin-2-yloxyethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 2-(5-methyl-3-pyridinyl)-5-phenyl-N-(2-pyrazin-2-yloxyethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 118124145 |
| Molecular Formula | C24H21N7O |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-(5-methyl-3-pyridinyl)-5-phenyl-N-(2-pyrazin-2-yloxyethyl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Cc1cncc(-c2nc(NCCOc3cnccn3)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C24H21N7O/c1-17-13-19(15-26-14-17)23-29-24(28-10-12-32-21-16-25-8-9-27-21)22-20(7-11-31(22)30-23)18-5-3-2-4-6-18/h2-9,11,13-16H,10,12H2,1H3,(H,28,29,30) |
| InChIKey | NZRIPWCBQOXQDO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|