C26H24N4O3 — CID 118124170
N-(2-hydroxy-4-methylphenyl)-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 118124170) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 118124170 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CN(Cc3ccc(-n4cccn4)cc3)c3ccccc3O2)c(O)c1 |
| InChI | InChI=1S/C26H24N4O3/c1-18-7-12-21(23(31)15-18)28-26(32)25-17-29(22-5-2-3-6-24(22)33-25)16-19-8-10-20(11-9-19)30-14-4-13-27-30/h2-15,25,31H,16-17H2,1H3,(H,28,32) |
| InChIKey | LLDVMXJDONCYFV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|