C24H28F6O9S2 — CID 118124238
3-[4-[2-[5-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-2-oxoethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 118124238) has the molecular formula C24H28F6O9S2 and a molecular weight of 638.60 g/mol. Its IUPAC name is 3-[4-[2-[5-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-2-oxoethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-[2-[5-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-2-oxoethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118124238 |
| Molecular Formula | C24H28F6O9S2 |
| Molecular Weight | 638.60 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 3-[4-[2-[5-(2,2-dimethylbutanoyloxy)-2-bicyclo[2.2.1]heptanyl]-2-oxoethyl]phenoxy]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | CCC(C)(C)C(=O)OC1CC2CC1CC2C(=O)Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H28F6O9S2/c1-4-21(2,3)20(32)38-19-12-14-10-15(19)11-17(14)18(31)9-13-5-7-16(8-6-13)39-41(36,37)24(29,30)22(25,26)23(27,28)40(33,34)35/h5-8,14-15,17,19H,4,9-12H2,1-3H3,(H,33,34,35) |
| InChIKey | WVASOMGVFPXRMW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|