About 2-methyl-4-propan-2-yl-3,7-dihydroindazole
2-methyl-4-propan-2-yl-3,7-dihydroindazole (PubChem CID 118124524) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-methyl-4-propan-2-yl-3,7-dihydroindazole.
Molecular Properties
| Compound Name | 2-methyl-4-propan-2-yl-3,7-dihydroindazole |
| PubChem CID | 118124524 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-methyl-4-propan-2-yl-3,7-dihydroindazole |
| SMILES | CC(C)C1=C2CN(C)N=C2CC=C1 |
| InChI | InChI=1S/C11H16N2/c1-8(2)9-5-4-6-11-10(9)7-13(3)12-11/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | UPUVSJXZYABJKV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-4-propan-2-yl-3,7-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-propan-2-yl-3,7-dihydroindazole?
The IUPAC name of 2-methyl-4-propan-2-yl-3,7-dihydroindazole (CID 118124524) is 2-methyl-4-propan-2-yl-3,7-dihydroindazole.
What is the SMILES notation for 2-methyl-4-propan-2-yl-3,7-dihydroindazole?
The canonical SMILES for 2-methyl-4-propan-2-yl-3,7-dihydroindazole is CC(C)C1=C2CN(C)N=C2CC=C1.
What is the InChIKey of 2-methyl-4-propan-2-yl-3,7-dihydroindazole?
The InChIKey is UPUVSJXZYABJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-8(2)9-5-4-6-11-10(9)7-13(3)12-11/h4-5,8H,6-7H2,1-3H3.
What are the key properties of 2-methyl-4-propan-2-yl-3,7-dihydroindazole?
2-methyl-4-propan-2-yl-3,7-dihydroindazole has a molecular weight of 176.26 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-propan-2-yl-3,7-dihydroindazole is sourced from PubChem (CID 118124524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).