C29H26F3N7O2 — CID 118124591
(9S)-N-[3-[2-[(1-aminoethylideneamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124591) has the molecular formula C29H26F3N7O2 and a molecular weight of 561.57 g/mol. Its IUPAC name is (9S)-N-[3-[2-[(1-aminoethylideneamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[3-[2-[(1-aminoethylideneamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124591 |
| Molecular Formula | C29H26F3N7O2 |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | (9S)-N-[3-[2-[(1-aminoethylideneamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C/C(N)=N\Cc1ncc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CC[C@H]3C4)c2)o1 |
| InChI | InChI=1S/C29H26F3N7O2/c1-17(33)34-15-26-35-14-25(41-26)19-5-3-7-21(13-19)36-28(40)39-22-10-11-38(16-22)24-9-8-23(37-27(24)39)18-4-2-6-20(12-18)29(30,31)32/h2-9,12-14,22H,10-11,15-16H2,1H3,(H2,33,34)(H,36,40)/t22-/m0/s1 |
| InChIKey | VMUMVWGXKSAIFE-QFIPXVFZSA-N |
| XLogP | 5.93 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|