C24H23F2N5O2 — CID 118124602
(9S)-5-[3-(1,1-difluoroethyl)phenyl]-3-methoxy-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124602) has the molecular formula C24H23F2N5O2 and a molecular weight of 451.48 g/mol. Its IUPAC name is (9S)-5-[3-(1,1-difluoroethyl)phenyl]-3-methoxy-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[3-(1,1-difluoroethyl)phenyl]-3-methoxy-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124602 |
| Molecular Formula | C24H23F2N5O2 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (9S)-5-[3-(1,1-difluoroethyl)phenyl]-3-methoxy-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | COc1cc(-c2cccc(C(C)(F)F)c2)nc2c1N1CC[C@@H](C1)N2C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C24H23F2N5O2/c1-24(25,26)16-7-5-6-15(12-16)18-13-19(33-2)21-22(28-18)31(17-9-11-30(21)14-17)23(32)29-20-8-3-4-10-27-20/h3-8,10,12-13,17H,9,11,14H2,1-2H3,(H,27,29,32)/t17-/m0/s1 |
| InChIKey | MMFADEDKJBXXNO-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |