C26H26F3N7O — CID 118124627
(9S)-N-(4-piperidin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124627) has the molecular formula C26H26F3N7O and a molecular weight of 509.54 g/mol. Its IUPAC name is (9S)-N-(4-piperidin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-(4-piperidin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124627 |
| Molecular Formula | C26H26F3N7O |
| Molecular Weight | 509.54 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | (9S)-N-(4-piperidin-1-ylpyrimidin-2-yl)-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1nccc(N2CCCCC2)n1)N1c2nc(-c3cccc(C(F)(F)F)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C26H26F3N7O/c27-26(28,29)18-6-4-5-17(15-18)20-7-8-21-23(31-20)36(19-10-14-35(21)16-19)25(37)33-24-30-11-9-22(32-24)34-12-2-1-3-13-34/h4-9,11,15,19H,1-3,10,12-14,16H2,(H,30,32,33,37)/t19-/m0/s1 |
| InChIKey | FCEITGNTTLYGAM-IBGZPJMESA-N |
| XLogP | 5.18 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |