C35H29F3N6O3 — CID 118124630
(9S)-N-[3-[2-[(phenacylamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124630) has the molecular formula C35H29F3N6O3 and a molecular weight of 638.65 g/mol. Its IUPAC name is (9S)-N-[3-[2-[(phenacylamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[3-[2-[(phenacylamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124630 |
| Molecular Formula | C35H29F3N6O3 |
| Molecular Weight | 638.65 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | (9S)-N-[3-[2-[(phenacylamino)methyl]-1,3-oxazol-5-yl]phenyl]-5-[3-(trifluoromethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(CNCc1ncc(-c2cccc(NC(=O)N3c4nc(-c5cccc(C(F)(F)F)c5)ccc4N4CC[C@H]3C4)c2)o1)c1ccccc1 |
| InChI | InChI=1S/C35H29F3N6O3/c36-35(37,38)25-10-4-8-23(16-25)28-12-13-29-33(42-28)44(27-14-15-43(29)21-27)34(46)41-26-11-5-9-24(17-26)31-19-40-32(47-31)20-39-18-30(45)22-6-2-1-3-7-22/h1-13,16-17,19,27,39H,14-15,18,20-21H2,(H,41,46)/t27-/m0/s1 |
| InChIKey | KUXYCFOZIKPVHM-MHZLTWQESA-N |
| XLogP | 7.03 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.65 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |