C22H20F3N5O2 — CID 118124767
9-methoxy-N-pyridin-4-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124767) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is 9-methoxy-N-pyridin-4-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | 9-methoxy-N-pyridin-4-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124767 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 9-methoxy-N-pyridin-4-yl-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | COc1cc(-c2cccc(C(F)(F)F)c2)nc2c1NCCCN2C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C22H20F3N5O2/c1-32-18-13-17(14-4-2-5-15(12-14)22(23,24)25)29-20-19(18)27-8-3-11-30(20)21(31)28-16-6-9-26-10-7-16/h2,4-7,9-10,12-13,27H,3,8,11H2,1H3,(H,26,28,31) |
| InChIKey | UDBQNSXUKFSLKM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |