C20H29N7O — CID 118124852
7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N-(4-methyl-3H-pyrrol-2-yl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide (PubChem CID 118124852) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N-(4-methyl-3H-pyrrol-2-yl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide.
| Compound Name | 7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N-(4-methyl-3H-pyrrol-2-yl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
|---|---|
| PubChem CID | 118124852 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 7-[(3S)-3-(dimethylamino)pyrrolidin-1-yl]-N-(4-methyl-3H-pyrrol-2-yl)-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepine-5-carboxamide |
| SMILES | CC1=CN=C(NC(=O)N2CCCNc3ccc(N4CC[C@H](N(C)C)C4)nc32)C1 |
| InChI | InChI=1S/C20H29N7O/c1-14-11-17(22-12-14)23-20(28)27-9-4-8-21-16-5-6-18(24-19(16)27)26-10-7-15(13-26)25(2)3/h5-6,12,15,21H,4,7-11,13H2,1-3H3,(H,22,23,28)/t15-/m0/s1 |
| InChIKey | BEGROALJMMOUHO-HNNXBMFYSA-N |
| XLogP | 2.26 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |