C28H22F3N5O3 — CID 118125126
[(3R)-5-(pyridin-2-ylcarbamoyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepin-3-yl] benzoate (PubChem CID 118125126) has the molecular formula C28H22F3N5O3 and a molecular weight of 533.51 g/mol. Its IUPAC name is [(3R)-5-(pyridin-2-ylcarbamoyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepin-3-yl] benzoate.
| Compound Name | [(3R)-5-(pyridin-2-ylcarbamoyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepin-3-yl] benzoate |
|---|---|
| PubChem CID | 118125126 |
| Molecular Formula | C28H22F3N5O3 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | [(3R)-5-(pyridin-2-ylcarbamoyl)-7-[3-(trifluoromethyl)phenyl]-1,2,3,4-tetrahydropyrido[2,3-b][1,4]diazepin-3-yl] benzoate |
| SMILES | O=C(O[C@@H]1CNc2ccc(-c3cccc(C(F)(F)F)c3)nc2N(C(=O)Nc2ccccn2)C1)c1ccccc1 |
| InChI | InChI=1S/C28H22F3N5O3/c29-28(30,31)20-10-6-9-19(15-20)22-12-13-23-25(34-22)36(27(38)35-24-11-4-5-14-32-24)17-21(16-33-23)39-26(37)18-7-2-1-3-8-18/h1-15,21,33H,16-17H2,(H,32,35,38)/t21-/m1/s1 |
| InChIKey | LGPJTVUDSFPHBV-OAQYLSRUSA-N |
| XLogP | 5.85 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |