About methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid
methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid (PubChem CID 118125617) has the molecular formula C13H11Cl2N3O4
and a molecular weight of 344.15 g/mol. Its IUPAC name is methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid |
| PubChem CID | 118125617 |
| Molecular Formula | C13H11Cl2N3O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid |
| SMILES | COC(=O)c1nc(Cl)cc(N)c1Cl.O=C(O)c1ccccn1 |
| InChI | InChI=1S/C7H6Cl2N2O2.C6H5NO2/c1-13-7(12)6-5(9)3(10)2-4(8)11-6;8-6(9)5-3-1-2-4-7-5/h2H,1H3,(H2,10,11);1-4H,(H,8,9) |
| InChIKey | UWEURGDXUOKVCU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid?
The IUPAC name of methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid (CID 118125617) is methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid.
What is the SMILES notation for methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid?
The canonical SMILES for methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid is COC(=O)c1nc(Cl)cc(N)c1Cl.O=C(O)c1ccccn1.
What is the InChIKey of methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid?
The InChIKey is UWEURGDXUOKVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O2.C6H5NO2/c1-13-7(12)6-5(9)3(10)2-4(8)11-6;8-6(9)5-3-1-2-4-7-5/h2H,1H3,(H2,10,11);1-4H,(H,8,9).
What are the key properties of methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid?
methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid has a molecular weight of 344.15 g/mol, XLogP of 2.54, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,6-dichloropyridine-2-carboxylate;pyridine-2-carboxylic acid is sourced from PubChem (CID 118125617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).