About 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride
4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride (PubChem CID 118125948) has the molecular formula C18H23ClFNO2
and a molecular weight of 339.84 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride |
| PubChem CID | 118125948 |
| Molecular Formula | C18H23ClFNO2 |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride |
| SMILES | Cl.OC1(OCC2CCNCC2)C=CC(c2cccc(F)c2)=CC1 |
| InChI | InChI=1S/C18H22FNO2.ClH/c19-17-3-1-2-16(12-17)15-4-8-18(21,9-5-15)22-13-14-6-10-20-11-7-14;/h1-5,8,12,14,20-21H,6-7,9-11,13H2;1H |
| InChIKey | FYHFJYHNNFZTRJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride?
The IUPAC name of 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride (CID 118125948) is 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride.
What is the SMILES notation for 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride?
The canonical SMILES for 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride is Cl.OC1(OCC2CCNCC2)C=CC(c2cccc(F)c2)=CC1.
What is the InChIKey of 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride?
The InChIKey is FYHFJYHNNFZTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22FNO2.ClH/c19-17-3-1-2-16(12-17)15-4-8-18(21,9-5-15)22-13-14-6-10-20-11-7-14;/h1-5,8,12,14,20-21H,6-7,9-11,13H2;1H.
What are the key properties of 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride?
4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride has a molecular weight of 339.84 g/mol, XLogP of 3.30, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenyl)-1-(piperidin-4-ylmethoxy)cyclohexa-2,4-dien-1-ol;hydrochloride is sourced from PubChem (CID 118125948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).