C24H31ClFN6O7PS — CID 118126012
propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate (PubChem CID 118126012) has the molecular formula C24H31ClFN6O7PS and a molecular weight of 633.04 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 118126012 |
| Molecular Formula | C24H31ClFN6O7PS |
| Molecular Weight | 633.04 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,4R,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chloro-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphinothioyl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=S)(NC(C)C(=O)OC(C)C)Oc2ccccc2)[C@@H](O)[C@@]1(F)Cl |
| InChI | InChI=1S/C24H31ClFN6O7PS/c1-5-35-20-17-19(29-23(27)30-20)32(12-28-17)22-24(25,26)18(33)16(38-22)11-36-40(41,39-15-9-7-6-8-10-15)31-14(4)21(34)37-13(2)3/h6-10,12-14,16,18,22,33H,5,11H2,1-4H3,(H,31,41)(H2,27,29,30)/t14?,16-,18-,22-,24+,40?/m1/s1 |
| InChIKey | HLCHPVKFKXBKTA-DJMTWTKUSA-N |
| XLogP | 3.22 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.04 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|