C23H23N3O6S — CID 11812697
4-methoxy-1-[(2R,4S,5S)-5-[(4-nitrophenyl)sulfanylmethyl]-4-phenylmethoxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 11812697) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-methoxy-1-[(2R,4S,5S)-5-[(4-nitrophenyl)sulfanylmethyl]-4-phenylmethoxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-methoxy-1-[(2R,4S,5S)-5-[(4-nitrophenyl)sulfanylmethyl]-4-phenylmethoxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 11812697 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 4-methoxy-1-[(2R,4S,5S)-5-[(4-nitrophenyl)sulfanylmethyl]-4-phenylmethoxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1ccn([C@H]2C[C@H](OCc3ccccc3)[C@@H](CSc3ccc([N+](=O)[O-])cc3)O2)c(=O)n1 |
| InChI | InChI=1S/C23H23N3O6S/c1-30-21-11-12-25(23(27)24-21)22-13-19(31-14-16-5-3-2-4-6-16)20(32-22)15-33-18-9-7-17(8-10-18)26(28)29/h2-12,19-20,22H,13-15H2,1H3/t19-,20+,22+/m0/s1 |
| InChIKey | DOECTJGHFDAIEY-TUNNFDKTSA-N |
| XLogP | 3.83 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|