About US9732075, Example 3.40
US9732075, Example 3.40 (PubChem CID 118126997) has the molecular formula C27H25ClFN3O2
and a molecular weight of 478.00 g/mol. Its IUPAC name is [(2S,4R)-2-(5-chloro-4-methyl-1H-benzimidazol-2-yl)-4-methoxypyrrolidin-1-yl]-[2-(4-fluoro-3-methylphenyl)phenyl]methanone.
Molecular Properties
| Compound Name | US9732075, Example 3.40 |
| PubChem CID | 118126997 |
| Molecular Formula | C27H25ClFN3O2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | [(2S,4R)-2-(5-chloro-4-methyl-1H-benzimidazol-2-yl)-4-methoxypyrrolidin-1-yl]-[2-(4-fluoro-3-methylphenyl)phenyl]methanone |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2C(=O)N3C[C@@H](C[C@H]3C4=NC5=C(N4)C=CC(=C5C)Cl)OC)F |
| InChI | InChI=1S/C27H25ClFN3O2/c1-15-12-17(8-10-22(15)29)19-6-4-5-7-20(19)27(33)32-14-18(34-3)13-24(32)26-30-23-11-9-21(28)16(2)25(23)31-26/h4-12,18,24H,13-14H2,1-3H3,(H,30,31)/t18-,24+/m1/s1 |
| InChIKey | WURLOVAITMAHFC-KOSHJBKYSA-N |
| XLogP | 5.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | 728 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze US9732075, Example 3.40 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of US9732075, Example 3.40?
The IUPAC name of US9732075, Example 3.40 (CID 118126997) is [(2S,4R)-2-(5-chloro-4-methyl-1H-benzimidazol-2-yl)-4-methoxypyrrolidin-1-yl]-[2-(4-fluoro-3-methylphenyl)phenyl]methanone.
What is the SMILES notation for US9732075, Example 3.40?
The canonical SMILES for US9732075, Example 3.40 is CC1=C(C=CC(=C1)C2=CC=CC=C2C(=O)N3C[C@@H](C[C@H]3C4=NC5=C(N4)C=CC(=C5C)Cl)OC)F.
What is the InChIKey of US9732075, Example 3.40?
The InChIKey is WURLOVAITMAHFC-KOSHJBKYSA-N. The full InChI is InChI=1S/C27H25ClFN3O2/c1-15-12-17(8-10-22(15)29)19-6-4-5-7-20(19)27(33)32-14-18(34-3)13-24(32)26-30-23-11-9-21(28)16(2)25(23)31-26/h4-12,18,24H,13-14H2,1-3H3,(H,30,31)/t18-,24+/m1/s1.
What are the key properties of US9732075, Example 3.40?
US9732075, Example 3.40 has a molecular weight of 478.00 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for US9732075, Example 3.40 is sourced from PubChem (CID 118126997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).