About 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole
5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole (PubChem CID 118127345) has the molecular formula C13H16ClN3O
and a molecular weight of 265.74 g/mol. Its IUPAC name is 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole.
Molecular Properties
| Compound Name | 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole |
| PubChem CID | 118127345 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole |
| SMILES | CO[C@@H]1CN[C@H](c2nc3c(C)c(Cl)ccc3[nH]2)C1 |
| InChI | InChI=1S/C13H16ClN3O/c1-7-9(14)3-4-10-12(7)17-13(16-10)11-5-8(18-2)6-15-11/h3-4,8,11,15H,5-6H2,1-2H3,(H,16,17)/t8-,11-/m0/s1 |
| InChIKey | UIONWEYGQHJJBR-KWQFWETISA-N |
| XLogP | 2.57 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole?
The IUPAC name of 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole (CID 118127345) is 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole.
What is the SMILES notation for 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole?
The canonical SMILES for 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole is CO[C@@H]1CN[C@H](c2nc3c(C)c(Cl)ccc3[nH]2)C1.
What is the InChIKey of 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole?
The InChIKey is UIONWEYGQHJJBR-KWQFWETISA-N. The full InChI is InChI=1S/C13H16ClN3O/c1-7-9(14)3-4-10-12(7)17-13(16-10)11-5-8(18-2)6-15-11/h3-4,8,11,15H,5-6H2,1-2H3,(H,16,17)/t8-,11-/m0/s1.
What are the key properties of 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole?
5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole has a molecular weight of 265.74 g/mol, XLogP of 2.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(2S,4S)-4-methoxypyrrolidin-2-yl]-4-methyl-1H-benzimidazole is sourced from PubChem (CID 118127345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).