C24H23N2O4+ — CID 11812872
6,7-dimethoxy-2-[(4-nitrophenyl)methyl]-1-phenyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 11812872) has the molecular formula C24H23N2O4+ and a molecular weight of 403.46 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[(4-nitrophenyl)methyl]-1-phenyl-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 6,7-dimethoxy-2-[(4-nitrophenyl)methyl]-1-phenyl-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 11812872 |
| Molecular Formula | C24H23N2O4+ |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 6,7-dimethoxy-2-[(4-nitrophenyl)methyl]-1-phenyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | COc1cc2c(cc1OC)C(c1ccccc1)=[N+](Cc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C24H23N2O4/c1-29-22-14-19-12-13-25(16-17-8-10-20(11-9-17)26(27)28)24(18-6-4-3-5-7-18)21(19)15-23(22)30-2/h3-11,14-15H,12-13,16H2,1-2H3/q+1 |
| InChIKey | PPRQMDPFYLAAJD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|