C31H25N3O3 — CID 11812928
N-(4-benzamido-3-cyano-5-phenylmethoxy-2-prop-2-enylphenyl)benzamide (PubChem CID 11812928) has the molecular formula C31H25N3O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-(4-benzamido-3-cyano-5-phenylmethoxy-2-prop-2-enylphenyl)benzamide.
| Compound Name | N-(4-benzamido-3-cyano-5-phenylmethoxy-2-prop-2-enylphenyl)benzamide |
|---|---|
| PubChem CID | 11812928 |
| Molecular Formula | C31H25N3O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | N-(4-benzamido-3-cyano-5-phenylmethoxy-2-prop-2-enylphenyl)benzamide |
| SMILES | C=CCc1c(NC(=O)c2ccccc2)cc(OCc2ccccc2)c(NC(=O)c2ccccc2)c1C#N |
| InChI | InChI=1S/C31H25N3O3/c1-2-12-25-26(20-32)29(34-31(36)24-17-10-5-11-18-24)28(37-21-22-13-6-3-7-14-22)19-27(25)33-30(35)23-15-8-4-9-16-23/h2-11,13-19H,1,12,21H2,(H,33,35)(H,34,36) |
| InChIKey | SIOMZVCUPQNFSW-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|