C28H38N6O8 — CID 118129755
(2S)-2-[[(1S)-5-[4-[bis(pyridin-2-ylmethyl)amino]butanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 118129755) has the molecular formula C28H38N6O8 and a molecular weight of 586.65 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[4-[bis(pyridin-2-ylmethyl)amino]butanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[4-[bis(pyridin-2-ylmethyl)amino]butanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 118129755 |
| Molecular Formula | C28H38N6O8 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (2S)-2-[[(1S)-5-[4-[bis(pyridin-2-ylmethyl)amino]butanoylamino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CCCN(Cc1ccccn1)Cc1ccccn1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C28H38N6O8/c35-24(11-7-17-34(18-20-8-1-4-14-29-20)19-21-9-2-5-15-30-21)31-16-6-3-10-22(26(38)39)32-28(42)33-23(27(40)41)12-13-25(36)37/h1-2,4-5,8-9,14-15,22-23H,3,6-7,10-13,16-19H2,(H,31,35)(H,36,37)(H,38,39)(H,40,41)(H2,32,33,42)/t22-,23-/m0/s1 |
| InChIKey | AVYWAUMAVNXYHW-GOTSBHOMSA-N |
| XLogP | 1.62 |
| TPSA | 211.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|