C29H27F3N7O3S+ — CID 118129878
[5-cyano-2-[6-methoxycarbonyl-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]phenyl]methyl-dimethyl-(1,3-thiazol-4-ylmethyl)azanium (PubChem CID 118129878) has the molecular formula C29H27F3N7O3S+ and a molecular weight of 610.64 g/mol. Its IUPAC name is [5-cyano-2-[6-methoxycarbonyl-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]phenyl]methyl-dimethyl-(1,3-thiazol-4-ylmethyl)azanium.
| Compound Name | [5-cyano-2-[6-methoxycarbonyl-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]phenyl]methyl-dimethyl-(1,3-thiazol-4-ylmethyl)azanium |
|---|---|
| PubChem CID | 118129878 |
| Molecular Formula | C29H27F3N7O3S+ |
| Molecular Weight | 610.64 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | [5-cyano-2-[6-methoxycarbonyl-7-methyl-3-oxo-8-[3-(trifluoromethyl)phenyl]-2,5-dihydro-[1,2,4]triazolo[4,3-a]pyrimidin-5-yl]phenyl]methyl-dimethyl-(1,3-thiazol-4-ylmethyl)azanium |
| SMILES | COC(=O)C1=C(C)N(c2cccc(C(F)(F)F)c2)c2n[nH]c(=O)n2C1c1ccc(C#N)cc1C[N+](C)(C)Cc1cscn1 |
| InChI | InChI=1S/C29H26F3N7O3S/c1-17-24(26(40)42-4)25(23-9-8-18(12-33)10-19(23)13-39(2,3)14-21-15-43-16-34-21)38-27(35-36-28(38)41)37(17)22-7-5-6-20(11-22)29(30,31)32/h5-11,15-16,25H,13-14H2,1-4H3/p+1 |
| InChIKey | PSZMZRLYCJVOKG-UHFFFAOYSA-O |
| XLogP | 4.88 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|