C26H20N4O3 — CID 118129979
(3S)-3-[4-[[2-(4-cyanophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 118129979) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is (3S)-3-[4-[[2-(4-cyanophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[2-(4-cyanophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 118129979 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (3S)-3-[4-[[2-(4-cyanophenyl)-[1,2,4]triazolo[1,5-a]pyridin-6-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3nc(-c4ccc(C#N)cc4)nn3c2)cc1 |
| InChI | InChI=1S/C26H20N4O3/c1-2-3-22(14-25(31)32)20-9-11-23(12-10-20)33-17-19-6-13-24-28-26(29-30(24)16-19)21-7-4-18(15-27)5-8-21/h4-13,16,22H,14,17H2,1H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | RBQKELFVIZDWRC-QFIPXVFZSA-N |
| XLogP | 4.43 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|