C29H33N5O6S — CID 118130105
methyl 5-[N-[6-amino-5-[2-[3-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoyl]phenyl]ethynyl]pyridine-3-carbonyl]-S-methylsulfonimidoyl]pentanoate (PubChem CID 118130105) has the molecular formula C29H33N5O6S and a molecular weight of 579.68 g/mol. Its IUPAC name is methyl 5-[N-[6-amino-5-[2-[3-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoyl]phenyl]ethynyl]pyridine-3-carbonyl]-S-methylsulfonimidoyl]pentanoate.
| Compound Name | methyl 5-[N-[6-amino-5-[2-[3-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoyl]phenyl]ethynyl]pyridine-3-carbonyl]-S-methylsulfonimidoyl]pentanoate |
|---|---|
| PubChem CID | 118130105 |
| Molecular Formula | C29H33N5O6S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | methyl 5-[N-[6-amino-5-[2-[3-[(5-tert-butyl-1,2-oxazol-3-yl)carbamoyl]phenyl]ethynyl]pyridine-3-carbonyl]-S-methylsulfonimidoyl]pentanoate |
| SMILES | COC(=O)CCCCS(C)(=O)=NC(=O)c1cnc(N)c(C#Cc2cccc(C(=O)Nc3cc(C(C)(C)C)on3)c2)c1 |
| InChI | InChI=1S/C29H33N5O6S/c1-29(2,3)23-17-24(33-40-23)32-27(36)21-10-8-9-19(15-21)12-13-20-16-22(18-31-26(20)30)28(37)34-41(5,38)14-7-6-11-25(35)39-4/h8-10,15-18H,6-7,11,14H2,1-5H3,(H2,30,31)(H,32,33,36) |
| InChIKey | LFRLYJOQYBDOIR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 166.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|