About (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone
(4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone (PubChem CID 118130275) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone.
Molecular Properties
| Compound Name | (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone |
| PubChem CID | 118130275 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone |
| SMILES | CCN1CCN(C(=O)C2=CC=C(C)CC2)CC1 |
| InChI | InChI=1S/C14H22N2O/c1-3-15-8-10-16(11-9-15)14(17)13-6-4-12(2)5-7-13/h4,6H,3,5,7-11H2,1-2H3 |
| InChIKey | ZWYKSAFJXFZONN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone?
The IUPAC name of (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone (CID 118130275) is (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone.
What is the SMILES notation for (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone?
The canonical SMILES for (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone is CCN1CCN(C(=O)C2=CC=C(C)CC2)CC1.
What is the InChIKey of (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone?
The InChIKey is ZWYKSAFJXFZONN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-3-15-8-10-16(11-9-15)14(17)13-6-4-12(2)5-7-13/h4,6H,3,5,7-11H2,1-2H3.
What are the key properties of (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone?
(4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone has a molecular weight of 234.34 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylpiperazin-1-yl)-(4-methylcyclohexa-1,3-dien-1-yl)methanone is sourced from PubChem (CID 118130275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).