About 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one
4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one (PubChem CID 118131235) has the molecular formula C23H17N3O2S
and a molecular weight of 399.48 g/mol. Its IUPAC name is 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one.
Molecular Properties
| Compound Name | 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one |
| PubChem CID | 118131235 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one |
| SMILES | CC(Nc1ncnc2ccsc12)c1oc(=O)c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-14(26-22-21-18(11-12-29-21)24-13-25-22)20-19(15-7-3-2-4-8-15)16-9-5-6-10-17(16)23(27)28-20/h2-14H,1H3,(H,24,25,26) |
| InChIKey | JIWLVQUZNRWLJR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one?
The IUPAC name of 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one (CID 118131235) is 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one.
What is the SMILES notation for 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one?
The canonical SMILES for 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one is CC(Nc1ncnc2ccsc12)c1oc(=O)c2ccccc2c1-c1ccccc1.
What is the InChIKey of 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one?
The InChIKey is JIWLVQUZNRWLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O2S/c1-14(26-22-21-18(11-12-29-21)24-13-25-22)20-19(15-7-3-2-4-8-15)16-9-5-6-10-17(16)23(27)28-20/h2-14H,1H3,(H,24,25,26).
What are the key properties of 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one?
4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one has a molecular weight of 399.48 g/mol, XLogP of 5.64, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-3-[1-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]isochromen-1-one is sourced from PubChem (CID 118131235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).