C18H32N2O3S — CID 118131732
(3aR,4R,5R,6S,7aS)-4,5-dibutoxy-2-(dimethylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-6-carbaldehyde (PubChem CID 118131732) has the molecular formula C18H32N2O3S and a molecular weight of 356.53 g/mol. Its IUPAC name is (3aR,4R,5R,6S,7aS)-4,5-dibutoxy-2-(dimethylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-6-carbaldehyde.
| Compound Name | (3aR,4R,5R,6S,7aS)-4,5-dibutoxy-2-(dimethylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-6-carbaldehyde |
|---|---|
| PubChem CID | 118131732 |
| Molecular Formula | C18H32N2O3S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | (3aR,4R,5R,6S,7aS)-4,5-dibutoxy-2-(dimethylamino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-6-carbaldehyde |
| SMILES | CCCCO[C@@H]1[C@H]2N=C(N(C)C)S[C@H]2CC(C=O)[C@H]1OCCCC |
| InChI | InChI=1S/C18H32N2O3S/c1-5-7-9-22-16-13(12-21)11-14-15(17(16)23-10-8-6-2)19-18(24-14)20(3)4/h12-17H,5-11H2,1-4H3/t13?,14-,15-,16+,17+/m0/s1 |
| InChIKey | UANHGQLPVFNLGD-LMBMLGAESA-N |
| XLogP | 2.98 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|