C12H17NO2 — CID 118132077
ethyl 3,6-dimethylidene-1,2,5,7-tetrahydropyrrolizine-8-carboxylate (PubChem CID 118132077) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is ethyl 3,6-dimethylidene-1,2,5,7-tetrahydropyrrolizine-8-carboxylate.
| Compound Name | ethyl 3,6-dimethylidene-1,2,5,7-tetrahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 118132077 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | ethyl 3,6-dimethylidene-1,2,5,7-tetrahydropyrrolizine-8-carboxylate |
| SMILES | C=C1CN2C(=C)CCC2(C(=O)OCC)C1 |
| InChI | InChI=1S/C12H17NO2/c1-4-15-11(14)12-6-5-10(3)13(12)8-9(2)7-12/h2-8H2,1H3 |
| InChIKey | HZOGBZSRDDYDRW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|