C10H13FINO3 — CID 118132081
ethyl 6-fluoro-6-iodo-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate (PubChem CID 118132081) has the molecular formula C10H13FINO3 and a molecular weight of 341.12 g/mol. Its IUPAC name is ethyl 6-fluoro-6-iodo-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate.
| Compound Name | ethyl 6-fluoro-6-iodo-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate |
|---|---|
| PubChem CID | 118132081 |
| Molecular Formula | C10H13FINO3 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | ethyl 6-fluoro-6-iodo-3-oxo-1,2,5,7-tetrahydropyrrolizine-8-carboxylate |
| SMILES | CCOC(=O)C12CCC(=O)N1CC(F)(I)C2 |
| InChI | InChI=1S/C10H13FINO3/c1-2-16-8(15)9-4-3-7(14)13(9)6-10(11,12)5-9/h2-6H2,1H3 |
| InChIKey | SAVWIVHWDGPNDW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|