C23H34F19N7 — CID 118132356
7-(fluoromethyl)-1,4,10,13,17,20-hexakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane (PubChem CID 118132356) has the molecular formula C23H34F19N7 and a molecular weight of 769.54 g/mol. Its IUPAC name is 7-(fluoromethyl)-1,4,10,13,17,20-hexakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane.
| Compound Name | 7-(fluoromethyl)-1,4,10,13,17,20-hexakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
|---|---|
| PubChem CID | 118132356 |
| Molecular Formula | C23H34F19N7 |
| Molecular Weight | 769.54 g/mol |
| Exact Mass | 769.26 |
| IUPAC Name | 7-(fluoromethyl)-1,4,10,13,17,20-hexakis(trifluoromethyl)-1,4,7,10,13,17,20-heptazacyclotricosane |
| SMILES | FCN1CCN(C(F)(F)F)CCN(C(F)(F)F)CCCN(C(F)(F)F)CCN(C(F)(F)F)CCCN(C(F)(F)F)CCN(C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H34F19N7/c24-17-43-7-9-48(22(37,38)39)15-13-46(20(31,32)33)5-1-3-44(18(25,26)27)11-12-45(19(28,29)30)4-2-6-47(21(34,35)36)14-16-49(10-8-43)23(40,41)42/h1-17H2 |
| InChIKey | YIZLFDZNJVUNJX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 22.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.54 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|