C18H20N10O — CID 118132417
1-(diaminomethylidene)-3-[[3-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyrimidin-5-yl]phenyl]methyl]urea (PubChem CID 118132417) has the molecular formula C18H20N10O and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[[3-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyrimidin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[[3-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyrimidin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 118132417 |
| Molecular Formula | C18H20N10O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-(diaminomethylidene)-3-[[3-[2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyrimidin-5-yl]phenyl]methyl]urea |
| SMILES | NC(N)=NC(=O)NCc1cccc(-c2cnc(N3CCn4cnnc4C3)nc2)c1 |
| InChI | InChI=1S/C18H20N10O/c19-16(20)25-18(29)23-7-12-2-1-3-13(6-12)14-8-21-17(22-9-14)27-4-5-28-11-24-26-15(28)10-27/h1-3,6,8-9,11H,4-5,7,10H2,(H5,19,20,23,25,29) |
| InChIKey | XGHAVAQFOHSXJE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|