C13H14F2N2O3 — CID 118132807
(3S,4R)-4-[4-(dimethylamino)-2,6-difluorophenyl]-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 118132807) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is (3S,4R)-4-[4-(dimethylamino)-2,6-difluorophenyl]-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4R)-4-[4-(dimethylamino)-2,6-difluorophenyl]-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 118132807 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (3S,4R)-4-[4-(dimethylamino)-2,6-difluorophenyl]-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | CN(C)c1cc(F)c([C@@H]2CNC(=O)[C@H]2C(=O)O)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2O3/c1-17(2)6-3-8(14)10(9(15)4-6)7-5-16-12(18)11(7)13(19)20/h3-4,7,11H,5H2,1-2H3,(H,16,18)(H,19,20)/t7-,11-/m0/s1 |
| InChIKey | XJZUDYIIGCTRRV-CPCISQLKSA-N |
| XLogP | 0.94 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|